C28H15F13N2 — CID 176747453
2,3,5-triphenyl-6-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)pyrazine (PubChem CID 176747453) has the molecular formula C28H15F13N2 and a molecular weight of 626.42 g/mol. Its IUPAC name is 2,3,5-triphenyl-6-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)pyrazine.
| Compound Name | 2,3,5-triphenyl-6-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)pyrazine |
|---|---|
| PubChem CID | 176747453 |
| Molecular Formula | C28H15F13N2 |
| Molecular Weight | 626.42 g/mol |
| Exact Mass | 626.10 |
| IUPAC Name | 2,3,5-triphenyl-6-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)pyrazine |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)c1nc(-c2ccccc2)c(-c2ccccc2)nc1-c1ccccc1 |
| InChI | InChI=1S/C28H15F13N2/c29-23(30,24(31,32)25(33,34)26(35,36)27(37,38)28(39,40)41)22-21(18-14-8-3-9-15-18)42-19(16-10-4-1-5-11-16)20(43-22)17-12-6-2-7-13-17/h1-15H |
| InChIKey | SMWRFTMDNOOGIE-UHFFFAOYSA-N |
| XLogP | 9.67 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.42 |
| LogP ≤ 5 | 9.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|