C23H19F5N4O4 — CID 176747844
(9S)-4-[[3,5-difluoro-4-[[2-(trifluoromethyl)-4-pyridinyl]oxy]phenyl]methoxy]-11-oxa-1,5,7-triazatricyclo[7.5.0.02,7]tetradeca-2,4-dien-6-one (PubChem CID 176747844) has the molecular formula C23H19F5N4O4 and a molecular weight of 510.42 g/mol. Its IUPAC name is (9S)-4-[[3,5-difluoro-4-[[2-(trifluoromethyl)-4-pyridinyl]oxy]phenyl]methoxy]-11-oxa-1,5,7-triazatricyclo[7.5.0.02,7]tetradeca-2,4-dien-6-one.
| Compound Name | (9S)-4-[[3,5-difluoro-4-[[2-(trifluoromethyl)-4-pyridinyl]oxy]phenyl]methoxy]-11-oxa-1,5,7-triazatricyclo[7.5.0.02,7]tetradeca-2,4-dien-6-one |
|---|---|
| PubChem CID | 176747844 |
| Molecular Formula | C23H19F5N4O4 |
| Molecular Weight | 510.42 g/mol |
| Exact Mass | 510.13 |
| IUPAC Name | (9S)-4-[[3,5-difluoro-4-[[2-(trifluoromethyl)-4-pyridinyl]oxy]phenyl]methoxy]-11-oxa-1,5,7-triazatricyclo[7.5.0.02,7]tetradeca-2,4-dien-6-one |
| SMILES | O=c1nc(OCc2cc(F)c(Oc3ccnc(C(F)(F)F)c3)c(F)c2)cc2n1C[C@H]1COCCCN21 |
| InChI | InChI=1S/C23H19F5N4O4/c24-16-6-13(7-17(25)21(16)36-15-2-3-29-18(8-15)23(26,27)28)11-35-19-9-20-31-4-1-5-34-12-14(31)10-32(20)22(33)30-19/h2-3,6-9,14H,1,4-5,10-12H2/t14-/m0/s1 |
| InChIKey | SZQMXKDSWSIBBC-AWEZNQCLSA-N |
| XLogP | 3.92 |
| TPSA | 78.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.42 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |