C18H25NO2 — CID 176748118
[(2S,8R)-8-(2-methylpropyl)-1,2,3,5,6,7-hexahydropyrrolizin-2-yl] benzoate (PubChem CID 176748118) has the molecular formula C18H25NO2 and a molecular weight of 287.40 g/mol. Its IUPAC name is [(2S,8R)-8-(2-methylpropyl)-1,2,3,5,6,7-hexahydropyrrolizin-2-yl] benzoate.
| Compound Name | [(2S,8R)-8-(2-methylpropyl)-1,2,3,5,6,7-hexahydropyrrolizin-2-yl] benzoate |
|---|---|
| PubChem CID | 176748118 |
| Molecular Formula | C18H25NO2 |
| Molecular Weight | 287.40 g/mol |
| Exact Mass | 287.19 |
| IUPAC Name | [(2S,8R)-8-(2-methylpropyl)-1,2,3,5,6,7-hexahydropyrrolizin-2-yl] benzoate |
| SMILES | CC(C)C[C@@]12CCCN1C[C@@H](OC(=O)c1ccccc1)C2 |
| InChI | InChI=1S/C18H25NO2/c1-14(2)11-18-9-6-10-19(18)13-16(12-18)21-17(20)15-7-4-3-5-8-15/h3-5,7-8,14,16H,6,9-13H2,1-2H3/t16-,18+/m0/s1 |
| InChIKey | NYQOVEXXYYMDNQ-FUHWJXTLSA-N |
| XLogP | 3.50 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.40 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |