C22H36N4O — CID 176748291
5-[4-(3-tert-butyl-3-methylpiperidin-1-yl)piperidin-1-yl]-N-methylpyridine-2-carboxamide (PubChem CID 176748291) has the molecular formula C22H36N4O and a molecular weight of 372.56 g/mol. Its IUPAC name is 5-[4-(3-tert-butyl-3-methylpiperidin-1-yl)piperidin-1-yl]-N-methylpyridine-2-carboxamide.
| Compound Name | 5-[4-(3-tert-butyl-3-methylpiperidin-1-yl)piperidin-1-yl]-N-methylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 176748291 |
| Molecular Formula | C22H36N4O |
| Molecular Weight | 372.56 g/mol |
| Exact Mass | 372.29 |
| IUPAC Name | 5-[4-(3-tert-butyl-3-methylpiperidin-1-yl)piperidin-1-yl]-N-methylpyridine-2-carboxamide |
| SMILES | CNC(=O)c1ccc(N2CCC(N3CCCC(C)(C(C)(C)C)C3)CC2)cn1 |
| InChI | InChI=1S/C22H36N4O/c1-21(2,3)22(4)11-6-12-26(16-22)17-9-13-25(14-10-17)18-7-8-19(24-15-18)20(27)23-5/h7-8,15,17H,6,9-14,16H2,1-5H3,(H,23,27) |
| InChIKey | DCTVJRNCHPKYGU-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.56 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |