About dibutyl 2-[(1S,4R)-4-acetyloxycyclohex-2-en-1-yl]propanedioate
dibutyl 2-[(1S,4R)-4-acetyloxycyclohex-2-en-1-yl]propanedioate (PubChem CID 176748445) has the molecular formula C19H30O6
and a molecular weight of 354.44 g/mol. Its IUPAC name is dibutyl 2-[(1S,4R)-4-acetyloxycyclohex-2-en-1-yl]propanedioate.
Molecular Properties
| Compound Name | dibutyl 2-[(1S,4R)-4-acetyloxycyclohex-2-en-1-yl]propanedioate |
| PubChem CID | 176748445 |
| Molecular Formula | C19H30O6 |
| Molecular Weight | 354.44 g/mol |
| Exact Mass | 354.20 |
| IUPAC Name | dibutyl 2-[(1S,4R)-4-acetyloxycyclohex-2-en-1-yl]propanedioate |
| SMILES | CCCCOC(=O)C(C(=O)OCCCC)[C@@H]1C=C[C@H](OC(C)=O)CC1 |
| InChI | InChI=1S/C19H30O6/c1-4-6-12-23-18(21)17(19(22)24-13-7-5-2)15-8-10-16(11-9-15)25-14(3)20/h8,10,15-17H,4-7,9,11-13H2,1-3H3/t15-,16+/m1/s1 |
| InChIKey | PUZGFAPFGHMROW-CVEARBPZSA-N |
| XLogP | 3.19 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.44 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze dibutyl 2-[(1S,4R)-4-acetyloxycyclohex-2-en-1-yl]propanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dibutyl 2-[(1S,4R)-4-acetyloxycyclohex-2-en-1-yl]propanedioate?
The IUPAC name of dibutyl 2-[(1S,4R)-4-acetyloxycyclohex-2-en-1-yl]propanedioate (CID 176748445) is dibutyl 2-[(1S,4R)-4-acetyloxycyclohex-2-en-1-yl]propanedioate.
What is the SMILES notation for dibutyl 2-[(1S,4R)-4-acetyloxycyclohex-2-en-1-yl]propanedioate?
The canonical SMILES for dibutyl 2-[(1S,4R)-4-acetyloxycyclohex-2-en-1-yl]propanedioate is CCCCOC(=O)C(C(=O)OCCCC)[C@@H]1C=C[C@H](OC(C)=O)CC1.
What is the InChIKey of dibutyl 2-[(1S,4R)-4-acetyloxycyclohex-2-en-1-yl]propanedioate?
The InChIKey is PUZGFAPFGHMROW-CVEARBPZSA-N. The full InChI is InChI=1S/C19H30O6/c1-4-6-12-23-18(21)17(19(22)24-13-7-5-2)15-8-10-16(11-9-15)25-14(3)20/h8,10,15-17H,4-7,9,11-13H2,1-3H3/t15-,16+/m1/s1.
What are the key properties of dibutyl 2-[(1S,4R)-4-acetyloxycyclohex-2-en-1-yl]propanedioate?
dibutyl 2-[(1S,4R)-4-acetyloxycyclohex-2-en-1-yl]propanedioate has a molecular weight of 354.44 g/mol, XLogP of 3.19, 10 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for dibutyl 2-[(1S,4R)-4-acetyloxycyclohex-2-en-1-yl]propanedioate is sourced from PubChem (CID 176748445), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).