C38H22O2 — CID 176751785
7-(1,2,3,4,5,6,7,8-octadeuterio-10-phenylanthracen-9-yl)-3,20-dioxapentacyclo[11.7.0.02,10.04,9.014,19]icosa-1(13),2(10),4(9),5,7,11,14,16,18-nonaene (PubChem CID 176751785) has the molecular formula C38H22O2 and a molecular weight of 518.64 g/mol. Its IUPAC name is 7-(1,2,3,4,5,6,7,8-octadeuterio-10-phenylanthracen-9-yl)-3,20-dioxapentacyclo[11.7.0.02,10.04,9.014,19]icosa-1(13),2(10),4(9),5,7,11,14,16,18-nonaene.
| Compound Name | 7-(1,2,3,4,5,6,7,8-octadeuterio-10-phenylanthracen-9-yl)-3,20-dioxapentacyclo[11.7.0.02,10.04,9.014,19]icosa-1(13),2(10),4(9),5,7,11,14,16,18-nonaene |
|---|---|
| PubChem CID | 176751785 |
| Molecular Formula | C38H22O2 |
| Molecular Weight | 518.64 g/mol |
| Exact Mass | 518.21 |
| IUPAC Name | 7-(1,2,3,4,5,6,7,8-octadeuterio-10-phenylanthracen-9-yl)-3,20-dioxapentacyclo[11.7.0.02,10.04,9.014,19]icosa-1(13),2(10),4(9),5,7,11,14,16,18-nonaene |
| SMILES | [2H]c1c([2H])c([2H])c2c(-c3ccc4oc5c(ccc6c7ccccc7oc65)c4c3)c3c([2H])c([2H])c([2H])c([2H])c3c(-c3ccccc3)c2c1[2H] |
| InChI | InChI=1S/C38H22O2/c1-2-10-23(11-3-1)35-26-13-4-6-15-28(26)36(29-16-7-5-14-27(29)35)24-18-21-34-32(22-24)31-20-19-30-25-12-8-9-17-33(25)39-37(30)38(31)40-34/h1-22H/i4D,5D,6D,7D,13D,14D,15D,16D |
| InChIKey | CORYEOQIMITSGM-YCCSPNNJSA-N |
| XLogP | 11.13 |
| TPSA | 26.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.64 |
| LogP ≤ 5 | 11.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|