C20H21F3N6O2S2 — CID 176751958
N-(1-methylcyclopropyl)-4-(2-methyl-1,2,3,6-tetrahydropyridin-4-yl)-1-[5-(trifluoromethyl)-1,3,4-thiadiazol-2-yl]indazole-6-sulfonamide (PubChem CID 176751958) has the molecular formula C20H21F3N6O2S2 and a molecular weight of 498.56 g/mol. Its IUPAC name is N-(1-methylcyclopropyl)-4-(2-methyl-1,2,3,6-tetrahydropyridin-4-yl)-1-[5-(trifluoromethyl)-1,3,4-thiadiazol-2-yl]indazole-6-sulfonamide.
| Compound Name | N-(1-methylcyclopropyl)-4-(2-methyl-1,2,3,6-tetrahydropyridin-4-yl)-1-[5-(trifluoromethyl)-1,3,4-thiadiazol-2-yl]indazole-6-sulfonamide |
|---|---|
| PubChem CID | 176751958 |
| Molecular Formula | C20H21F3N6O2S2 |
| Molecular Weight | 498.56 g/mol |
| Exact Mass | 498.11 |
| IUPAC Name | N-(1-methylcyclopropyl)-4-(2-methyl-1,2,3,6-tetrahydropyridin-4-yl)-1-[5-(trifluoromethyl)-1,3,4-thiadiazol-2-yl]indazole-6-sulfonamide |
| SMILES | CC1CC(c2cc(S(=O)(=O)NC3(C)CC3)cc3c2cnn3-c2nnc(C(F)(F)F)s2)=CCN1 |
| InChI | InChI=1S/C20H21F3N6O2S2/c1-11-7-12(3-6-24-11)14-8-13(33(30,31)28-19(2)4-5-19)9-16-15(14)10-25-29(16)18-27-26-17(32-18)20(21,22)23/h3,8-11,24,28H,4-7H2,1-2H3 |
| InChIKey | BGHXRMCYBWMZDX-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 101.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.56 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |