C13H20O4 — CID 176752004
(2,2-dimethyl-7-prop-2-enoxy-3a,4,7,7a-tetrahydro-1,3-benzodioxol-5-yl)methanol (PubChem CID 176752004) has the molecular formula C13H20O4 and a molecular weight of 240.30 g/mol. Its IUPAC name is (2,2-dimethyl-7-prop-2-enoxy-3a,4,7,7a-tetrahydro-1,3-benzodioxol-5-yl)methanol.
| Compound Name | (2,2-dimethyl-7-prop-2-enoxy-3a,4,7,7a-tetrahydro-1,3-benzodioxol-5-yl)methanol |
|---|---|
| PubChem CID | 176752004 |
| Molecular Formula | C13H20O4 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | (2,2-dimethyl-7-prop-2-enoxy-3a,4,7,7a-tetrahydro-1,3-benzodioxol-5-yl)methanol |
| SMILES | C=CCOC1C=C(CO)CC2OC(C)(C)OC12 |
| InChI | InChI=1S/C13H20O4/c1-4-5-15-10-6-9(8-14)7-11-12(10)17-13(2,3)16-11/h4,6,10-12,14H,1,5,7-8H2,2-3H3 |
| InChIKey | JOBUZSWATWDKHG-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|