About 3-iodo-5,7-di(propan-2-yl)-1H-pyrrolo[3,2-b]pyridine
3-iodo-5,7-di(propan-2-yl)-1H-pyrrolo[3,2-b]pyridine (PubChem CID 176754448) has the molecular formula C13H17IN2
and a molecular weight of 328.20 g/mol. Its IUPAC name is 3-iodo-5,7-di(propan-2-yl)-1H-pyrrolo[3,2-b]pyridine.
Molecular Properties
| Compound Name | 3-iodo-5,7-di(propan-2-yl)-1H-pyrrolo[3,2-b]pyridine |
| PubChem CID | 176754448 |
| Molecular Formula | C13H17IN2 |
| Molecular Weight | 328.20 g/mol |
| Exact Mass | 328.04 |
| IUPAC Name | 3-iodo-5,7-di(propan-2-yl)-1H-pyrrolo[3,2-b]pyridine |
| SMILES | CC(C)c1cc(C(C)C)c2[nH]cc(I)c2n1 |
| InChI | InChI=1S/C13H17IN2/c1-7(2)9-5-11(8(3)4)16-13-10(14)6-15-12(9)13/h5-8,15H,1-4H3 |
| InChIKey | QDQQEPFYXTUQRN-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.20 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 3-iodo-5,7-di(propan-2-yl)-1H-pyrrolo[3,2-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-iodo-5,7-di(propan-2-yl)-1H-pyrrolo[3,2-b]pyridine?
The IUPAC name of 3-iodo-5,7-di(propan-2-yl)-1H-pyrrolo[3,2-b]pyridine (CID 176754448) is 3-iodo-5,7-di(propan-2-yl)-1H-pyrrolo[3,2-b]pyridine.
What is the SMILES notation for 3-iodo-5,7-di(propan-2-yl)-1H-pyrrolo[3,2-b]pyridine?
The canonical SMILES for 3-iodo-5,7-di(propan-2-yl)-1H-pyrrolo[3,2-b]pyridine is CC(C)c1cc(C(C)C)c2[nH]cc(I)c2n1.
What is the InChIKey of 3-iodo-5,7-di(propan-2-yl)-1H-pyrrolo[3,2-b]pyridine?
The InChIKey is QDQQEPFYXTUQRN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17IN2/c1-7(2)9-5-11(8(3)4)16-13-10(14)6-15-12(9)13/h5-8,15H,1-4H3.
What are the key properties of 3-iodo-5,7-di(propan-2-yl)-1H-pyrrolo[3,2-b]pyridine?
3-iodo-5,7-di(propan-2-yl)-1H-pyrrolo[3,2-b]pyridine has a molecular weight of 328.20 g/mol, XLogP of 4.41, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-iodo-5,7-di(propan-2-yl)-1H-pyrrolo[3,2-b]pyridine is sourced from PubChem (CID 176754448), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).