C34H41F2N7O — CID 176754464
4-[[(3,3-difluorocyclohexyl)methylamino]methyl]-N-[3-[3-isocyano-1-[(4-methyl-1,2,4-triazol-3-yl)methyl]cyclobutyl]phenyl]-7,7-dimethyl-5,6-dihydrocyclopenta[b]pyridine-2-carboxamide (PubChem CID 176754464) has the molecular formula C34H41F2N7O and a molecular weight of 601.75 g/mol. Its IUPAC name is 4-[[(3,3-difluorocyclohexyl)methylamino]methyl]-N-[3-[3-isocyano-1-[(4-methyl-1,2,4-triazol-3-yl)methyl]cyclobutyl]phenyl]-7,7-dimethyl-5,6-dihydrocyclopenta[b]pyridine-2-carboxamide.
| Compound Name | 4-[[(3,3-difluorocyclohexyl)methylamino]methyl]-N-[3-[3-isocyano-1-[(4-methyl-1,2,4-triazol-3-yl)methyl]cyclobutyl]phenyl]-7,7-dimethyl-5,6-dihydrocyclopenta[b]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 176754464 |
| Molecular Formula | C34H41F2N7O |
| Molecular Weight | 601.75 g/mol |
| Exact Mass | 601.33 |
| IUPAC Name | 4-[[(3,3-difluorocyclohexyl)methylamino]methyl]-N-[3-[3-isocyano-1-[(4-methyl-1,2,4-triazol-3-yl)methyl]cyclobutyl]phenyl]-7,7-dimethyl-5,6-dihydrocyclopenta[b]pyridine-2-carboxamide |
| SMILES | [C-]#[N+]C1CC(Cc2nncn2C)(c2cccc(NC(=O)c3cc(CNCC4CCCC(F)(F)C4)c4c(n3)C(C)(C)CC4)c2)C1 |
| InChI | InChI=1S/C34H41F2N7O/c1-32(2)12-10-27-23(20-38-19-22-7-6-11-34(35,36)15-22)13-28(41-30(27)32)31(44)40-25-9-5-8-24(14-25)33(16-26(17-33)37-3)18-29-42-39-21-43(29)4/h5,8-9,13-14,21-22,26,38H,6-7,10-12,15-20H2,1-2,4H3,(H,40,44) |
| InChIKey | YFBIQYDLTNNRGL-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 89.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.75 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|