C20H25NO3 — CID 176754636
(2S,6S)-2,6-bis(phenylmethoxymethyl)morpholine (PubChem CID 176754636) has the molecular formula C20H25NO3 and a molecular weight of 327.42 g/mol. Its IUPAC name is (2S,6S)-2,6-bis(phenylmethoxymethyl)morpholine.
| Compound Name | (2S,6S)-2,6-bis(phenylmethoxymethyl)morpholine |
|---|---|
| PubChem CID | 176754636 |
| Molecular Formula | C20H25NO3 |
| Molecular Weight | 327.42 g/mol |
| Exact Mass | 327.18 |
| IUPAC Name | (2S,6S)-2,6-bis(phenylmethoxymethyl)morpholine |
| SMILES | c1ccc(COC[C@@H]2CNC[C@@H](COCc3ccccc3)O2)cc1 |
| InChI | InChI=1S/C20H25NO3/c1-3-7-17(8-4-1)13-22-15-19-11-21-12-20(24-19)16-23-14-18-9-5-2-6-10-18/h1-10,19-21H,11-16H2/t19-,20-/m0/s1 |
| InChIKey | SQHWTCXRDGKXAF-PMACEKPBSA-N |
| XLogP | 2.78 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.42 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |