C46H27N3O2S — CID 176754949
3-[4-phenyl-6-(9,9'-spirobi[fluorene]-2-yl)-1,3,5-triazin-2-yl]dibenzothiophene 5,5-dioxide (PubChem CID 176754949) has the molecular formula C46H27N3O2S and a molecular weight of 685.81 g/mol. Its IUPAC name is 3-[4-phenyl-6-(9,9'-spirobi[fluorene]-2-yl)-1,3,5-triazin-2-yl]dibenzothiophene 5,5-dioxide.
| Compound Name | 3-[4-phenyl-6-(9,9'-spirobi[fluorene]-2-yl)-1,3,5-triazin-2-yl]dibenzothiophene 5,5-dioxide |
|---|---|
| PubChem CID | 176754949 |
| Molecular Formula | C46H27N3O2S |
| Molecular Weight | 685.81 g/mol |
| Exact Mass | 685.18 |
| IUPAC Name | 3-[4-phenyl-6-(9,9'-spirobi[fluorene]-2-yl)-1,3,5-triazin-2-yl]dibenzothiophene 5,5-dioxide |
| SMILES | O=S1(=O)c2ccccc2-c2ccc(-c3nc(-c4ccccc4)nc(-c4ccc5c(c4)C4(c6ccccc6-c6ccccc64)c4ccccc4-5)n3)cc21 |
| InChI | InChI=1S/C46H27N3O2S/c50-52(51)41-21-11-7-17-35(41)36-25-23-30(27-42(36)52)45-48-43(28-12-2-1-3-13-28)47-44(49-45)29-22-24-34-33-16-6-10-20-39(33)46(40(34)26-29)37-18-8-4-14-31(37)32-15-5-9-19-38(32)46/h1-27H |
| InChIKey | LOOQIJWUWYLODJ-UHFFFAOYSA-N |
| XLogP | 10.03 |
| TPSA | 72.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.81 |
| LogP ≤ 5 | 10.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |