C39H23N3O3S — CID 176754995
8-dibenzofuran-3-yl-1-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzothiophene 5,5-dioxide (PubChem CID 176754995) has the molecular formula C39H23N3O3S and a molecular weight of 613.70 g/mol. Its IUPAC name is 8-dibenzofuran-3-yl-1-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzothiophene 5,5-dioxide.
| Compound Name | 8-dibenzofuran-3-yl-1-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzothiophene 5,5-dioxide |
|---|---|
| PubChem CID | 176754995 |
| Molecular Formula | C39H23N3O3S |
| Molecular Weight | 613.70 g/mol |
| Exact Mass | 613.15 |
| IUPAC Name | 8-dibenzofuran-3-yl-1-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzothiophene 5,5-dioxide |
| SMILES | O=S1(=O)c2ccc(-c3ccc4c(c3)oc3ccccc34)cc2-c2c(-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)cccc21 |
| InChI | InChI=1S/C39H23N3O3S/c43-46(44)34-21-19-26(27-18-20-29-28-14-7-8-16-32(28)45-33(29)23-27)22-31(34)36-30(15-9-17-35(36)46)39-41-37(24-10-3-1-4-11-24)40-38(42-39)25-12-5-2-6-13-25/h1-23H |
| InChIKey | OKRUBFJNVIQCRC-UHFFFAOYSA-N |
| XLogP | 9.25 |
| TPSA | 85.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.70 |
| LogP ≤ 5 | 9.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |