C33H30F2I2O9S — CID 176755597
2-[2-[3-(9,10-dihydroanthracen-9-yl)-4-(1-methylcyclopentyl)oxy-4-oxobutanoyl]oxy-3,5-diiodobenzoyl]oxy-1,1-difluoroethanesulfonic acid (PubChem CID 176755597) has the molecular formula C33H30F2I2O9S and a molecular weight of 894.46 g/mol. Its IUPAC name is 2-[2-[3-(9,10-dihydroanthracen-9-yl)-4-(1-methylcyclopentyl)oxy-4-oxobutanoyl]oxy-3,5-diiodobenzoyl]oxy-1,1-difluoroethanesulfonic acid.
| Compound Name | 2-[2-[3-(9,10-dihydroanthracen-9-yl)-4-(1-methylcyclopentyl)oxy-4-oxobutanoyl]oxy-3,5-diiodobenzoyl]oxy-1,1-difluoroethanesulfonic acid |
|---|---|
| PubChem CID | 176755597 |
| Molecular Formula | C33H30F2I2O9S |
| Molecular Weight | 894.46 g/mol |
| Exact Mass | 893.97 |
| IUPAC Name | 2-[2-[3-(9,10-dihydroanthracen-9-yl)-4-(1-methylcyclopentyl)oxy-4-oxobutanoyl]oxy-3,5-diiodobenzoyl]oxy-1,1-difluoroethanesulfonic acid |
| SMILES | CC1(OC(=O)C(CC(=O)Oc2c(I)cc(I)cc2C(=O)OCC(F)(F)S(=O)(=O)O)C2c3ccccc3Cc3ccccc32)CCCC1 |
| InChI | InChI=1S/C33H30F2I2O9S/c1-32(12-6-7-13-32)46-31(40)24(28-22-10-4-2-8-19(22)14-20-9-3-5-11-23(20)28)17-27(38)45-29-25(15-21(36)16-26(29)37)30(39)44-18-33(34,35)47(41,42)43/h2-5,8-11,15-16,24,28H,6-7,12-14,17-18H2,1H3,(H,41,42,43) |
| InChIKey | HVEBHPWSVKFUBF-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 133.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 894.46 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|