C13H17IO5S — CID 176755857
(2S,3S,4S,5S,6R)-2-[hydroxy(iodo)methyl]-6-(4-methylphenyl)sulfanyloxane-3,4,5-triol (PubChem CID 176755857) has the molecular formula C13H17IO5S and a molecular weight of 412.25 g/mol. Its IUPAC name is (2S,3S,4S,5S,6R)-2-[hydroxy(iodo)methyl]-6-(4-methylphenyl)sulfanyloxane-3,4,5-triol.
| Compound Name | (2S,3S,4S,5S,6R)-2-[hydroxy(iodo)methyl]-6-(4-methylphenyl)sulfanyloxane-3,4,5-triol |
|---|---|
| PubChem CID | 176755857 |
| Molecular Formula | C13H17IO5S |
| Molecular Weight | 412.25 g/mol |
| Exact Mass | 411.98 |
| IUPAC Name | (2S,3S,4S,5S,6R)-2-[hydroxy(iodo)methyl]-6-(4-methylphenyl)sulfanyloxane-3,4,5-triol |
| SMILES | Cc1ccc(S[C@H]2O[C@H](C(O)I)[C@@H](O)[C@H](O)[C@@H]2O)cc1 |
| InChI | InChI=1S/C13H17IO5S/c1-6-2-4-7(5-3-6)20-13-10(17)8(15)9(16)11(19-13)12(14)18/h2-5,8-13,15-18H,1H3/t8-,9-,10-,11-,12?,13+/m0/s1 |
| InChIKey | PDFQZJSCILWBPH-LGEJYLRWSA-N |
| XLogP | 0.65 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.25 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|