About (E)-N'-(2,2-dimethylpropyl)-N-(2-hydroxyethyl)but-2-enediamide
(E)-N'-(2,2-dimethylpropyl)-N-(2-hydroxyethyl)but-2-enediamide (PubChem CID 176757892) has the molecular formula C11H20N2O3
and a molecular weight of 228.29 g/mol. Its IUPAC name is (E)-N'-(2,2-dimethylpropyl)-N-(2-hydroxyethyl)but-2-enediamide.
Molecular Properties
| Compound Name | (E)-N'-(2,2-dimethylpropyl)-N-(2-hydroxyethyl)but-2-enediamide |
| PubChem CID | 176757892 |
| Molecular Formula | C11H20N2O3 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.15 |
| IUPAC Name | (E)-N'-(2,2-dimethylpropyl)-N-(2-hydroxyethyl)but-2-enediamide |
| SMILES | CC(C)(C)CNC(=O)/C=C/C(=O)NCCO |
| InChI | InChI=1S/C11H20N2O3/c1-11(2,3)8-13-10(16)5-4-9(15)12-6-7-14/h4-5,14H,6-8H2,1-3H3,(H,12,15)(H,13,16)/b5-4+ |
| InChIKey | VDLNDOOSIIKCQB-SNAWJCMRSA-N |
| XLogP | -0.19 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-N'-(2,2-dimethylpropyl)-N-(2-hydroxyethyl)but-2-enediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-N'-(2,2-dimethylpropyl)-N-(2-hydroxyethyl)but-2-enediamide?
The IUPAC name of (E)-N'-(2,2-dimethylpropyl)-N-(2-hydroxyethyl)but-2-enediamide (CID 176757892) is (E)-N'-(2,2-dimethylpropyl)-N-(2-hydroxyethyl)but-2-enediamide.
What is the SMILES notation for (E)-N'-(2,2-dimethylpropyl)-N-(2-hydroxyethyl)but-2-enediamide?
The canonical SMILES for (E)-N'-(2,2-dimethylpropyl)-N-(2-hydroxyethyl)but-2-enediamide is CC(C)(C)CNC(=O)/C=C/C(=O)NCCO.
What is the InChIKey of (E)-N'-(2,2-dimethylpropyl)-N-(2-hydroxyethyl)but-2-enediamide?
The InChIKey is VDLNDOOSIIKCQB-SNAWJCMRSA-N. The full InChI is InChI=1S/C11H20N2O3/c1-11(2,3)8-13-10(16)5-4-9(15)12-6-7-14/h4-5,14H,6-8H2,1-3H3,(H,12,15)(H,13,16)/b5-4+.
What are the key properties of (E)-N'-(2,2-dimethylpropyl)-N-(2-hydroxyethyl)but-2-enediamide?
(E)-N'-(2,2-dimethylpropyl)-N-(2-hydroxyethyl)but-2-enediamide has a molecular weight of 228.29 g/mol, XLogP of -0.19, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-N'-(2,2-dimethylpropyl)-N-(2-hydroxyethyl)but-2-enediamide is sourced from PubChem (CID 176757892), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).