C29H24F3N5O4 — CID 176758224
N-[(4S,5R)-7-ethyl-3-methyl-4-(2-nitrophenyl)-6-oxo-1-phenyl-4,5-dihydropyrazolo[5,4-b]pyridin-5-yl]-3-(trifluoromethyl)benzamide (PubChem CID 176758224) has the molecular formula C29H24F3N5O4 and a molecular weight of 563.54 g/mol. Its IUPAC name is N-[(4S,5R)-7-ethyl-3-methyl-4-(2-nitrophenyl)-6-oxo-1-phenyl-4,5-dihydropyrazolo[5,4-b]pyridin-5-yl]-3-(trifluoromethyl)benzamide.
| Compound Name | N-[(4S,5R)-7-ethyl-3-methyl-4-(2-nitrophenyl)-6-oxo-1-phenyl-4,5-dihydropyrazolo[5,4-b]pyridin-5-yl]-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 176758224 |
| Molecular Formula | C29H24F3N5O4 |
| Molecular Weight | 563.54 g/mol |
| Exact Mass | 563.18 |
| IUPAC Name | N-[(4S,5R)-7-ethyl-3-methyl-4-(2-nitrophenyl)-6-oxo-1-phenyl-4,5-dihydropyrazolo[5,4-b]pyridin-5-yl]-3-(trifluoromethyl)benzamide |
| SMILES | CCN1C(=O)[C@H](NC(=O)c2cccc(C(F)(F)F)c2)[C@@H](c2ccccc2[N+](=O)[O-])c2c(C)nn(-c3ccccc3)c21 |
| InChI | InChI=1S/C29H24F3N5O4/c1-3-35-27-23(17(2)34-36(27)20-12-5-4-6-13-20)24(21-14-7-8-15-22(21)37(40)41)25(28(35)39)33-26(38)18-10-9-11-19(16-18)29(30,31)32/h4-16,24-25H,3H2,1-2H3,(H,33,38)/t24-,25+/m0/s1 |
| InChIKey | KPSWDSNLCLWHLA-LOSJGSFVSA-N |
| XLogP | 5.40 |
| TPSA | 110.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.54 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|