C8H7N5 — CID 176758388
8-isocyano-5,7-dimethyl-[1,2,4]triazolo[1,5-c]pyrimidine (PubChem CID 176758388) has the molecular formula C8H7N5 and a molecular weight of 173.18 g/mol. Its IUPAC name is 8-isocyano-5,7-dimethyl-[1,2,4]triazolo[1,5-c]pyrimidine.
| Compound Name | 8-isocyano-5,7-dimethyl-[1,2,4]triazolo[1,5-c]pyrimidine |
|---|---|
| PubChem CID | 176758388 |
| Molecular Formula | C8H7N5 |
| Molecular Weight | 173.18 g/mol |
| Exact Mass | 173.07 |
| IUPAC Name | 8-isocyano-5,7-dimethyl-[1,2,4]triazolo[1,5-c]pyrimidine |
| SMILES | [C-]#[N+]c1c(C)nc(C)n2ncnc12 |
| InChI | InChI=1S/C8H7N5/c1-5-7(9-3)8-10-4-11-13(8)6(2)12-5/h4H,1-2H3 |
| InChIKey | BPGNDHMNMHKVIG-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 47.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.18 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|