About 7-isocyano-4,6-dimethyl-1,3-dihydrothieno[3,4-c]pyridine
7-isocyano-4,6-dimethyl-1,3-dihydrothieno[3,4-c]pyridine (PubChem CID 176758444) has the molecular formula C10H10N2S
and a molecular weight of 190.27 g/mol. Its IUPAC name is 7-isocyano-4,6-dimethyl-1,3-dihydrothieno[3,4-c]pyridine.
Molecular Properties
| Compound Name | 7-isocyano-4,6-dimethyl-1,3-dihydrothieno[3,4-c]pyridine |
| PubChem CID | 176758444 |
| Molecular Formula | C10H10N2S |
| Molecular Weight | 190.27 g/mol |
| Exact Mass | 190.06 |
| IUPAC Name | 7-isocyano-4,6-dimethyl-1,3-dihydrothieno[3,4-c]pyridine |
| SMILES | [C-]#[N+]c1c(C)nc(C)c2c1CSC2 |
| InChI | InChI=1S/C10H10N2S/c1-6-8-4-13-5-9(8)10(11-3)7(2)12-6/h4-5H2,1-2H3 |
| InChIKey | SYAKJLYVGBNRHM-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 17.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.27 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 7-isocyano-4,6-dimethyl-1,3-dihydrothieno[3,4-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-isocyano-4,6-dimethyl-1,3-dihydrothieno[3,4-c]pyridine?
The IUPAC name of 7-isocyano-4,6-dimethyl-1,3-dihydrothieno[3,4-c]pyridine (CID 176758444) is 7-isocyano-4,6-dimethyl-1,3-dihydrothieno[3,4-c]pyridine.
What is the SMILES notation for 7-isocyano-4,6-dimethyl-1,3-dihydrothieno[3,4-c]pyridine?
The canonical SMILES for 7-isocyano-4,6-dimethyl-1,3-dihydrothieno[3,4-c]pyridine is [C-]#[N+]c1c(C)nc(C)c2c1CSC2.
What is the InChIKey of 7-isocyano-4,6-dimethyl-1,3-dihydrothieno[3,4-c]pyridine?
The InChIKey is SYAKJLYVGBNRHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N2S/c1-6-8-4-13-5-9(8)10(11-3)7(2)12-6/h4-5H2,1-2H3.
What are the key properties of 7-isocyano-4,6-dimethyl-1,3-dihydrothieno[3,4-c]pyridine?
7-isocyano-4,6-dimethyl-1,3-dihydrothieno[3,4-c]pyridine has a molecular weight of 190.27 g/mol, XLogP of 3.00, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-isocyano-4,6-dimethyl-1,3-dihydrothieno[3,4-c]pyridine is sourced from PubChem (CID 176758444), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).