About 4-isocyano-1,3-dimethyl-6,7-dihydro-5H-cyclopenta[c]pyridine
4-isocyano-1,3-dimethyl-6,7-dihydro-5H-cyclopenta[c]pyridine (PubChem CID 176758527) has the molecular formula C11H12N2
and a molecular weight of 172.23 g/mol. Its IUPAC name is 4-isocyano-1,3-dimethyl-6,7-dihydro-5H-cyclopenta[c]pyridine.
Molecular Properties
| Compound Name | 4-isocyano-1,3-dimethyl-6,7-dihydro-5H-cyclopenta[c]pyridine |
| PubChem CID | 176758527 |
| Molecular Formula | C11H12N2 |
| Molecular Weight | 172.23 g/mol |
| Exact Mass | 172.10 |
| IUPAC Name | 4-isocyano-1,3-dimethyl-6,7-dihydro-5H-cyclopenta[c]pyridine |
| SMILES | [C-]#[N+]c1c(C)nc(C)c2c1CCC2 |
| InChI | InChI=1S/C11H12N2/c1-7-9-5-4-6-10(9)11(12-3)8(2)13-7/h4-6H2,1-2H3 |
| InChIKey | OUZNJMGWOWLWCF-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 17.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.23 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 4-isocyano-1,3-dimethyl-6,7-dihydro-5H-cyclopenta[c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-isocyano-1,3-dimethyl-6,7-dihydro-5H-cyclopenta[c]pyridine?
The IUPAC name of 4-isocyano-1,3-dimethyl-6,7-dihydro-5H-cyclopenta[c]pyridine (CID 176758527) is 4-isocyano-1,3-dimethyl-6,7-dihydro-5H-cyclopenta[c]pyridine.
What is the SMILES notation for 4-isocyano-1,3-dimethyl-6,7-dihydro-5H-cyclopenta[c]pyridine?
The canonical SMILES for 4-isocyano-1,3-dimethyl-6,7-dihydro-5H-cyclopenta[c]pyridine is [C-]#[N+]c1c(C)nc(C)c2c1CCC2.
What is the InChIKey of 4-isocyano-1,3-dimethyl-6,7-dihydro-5H-cyclopenta[c]pyridine?
The InChIKey is OUZNJMGWOWLWCF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N2/c1-7-9-5-4-6-10(9)11(12-3)8(2)13-7/h4-6H2,1-2H3.
What are the key properties of 4-isocyano-1,3-dimethyl-6,7-dihydro-5H-cyclopenta[c]pyridine?
4-isocyano-1,3-dimethyl-6,7-dihydro-5H-cyclopenta[c]pyridine has a molecular weight of 172.23 g/mol, XLogP of 2.74, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-isocyano-1,3-dimethyl-6,7-dihydro-5H-cyclopenta[c]pyridine is sourced from PubChem (CID 176758527), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).