C43H25NO2 — CID 176758659
2-[3-[3-(3,5,6-trideuterio-1-azapentacyclo[10.6.1.02,7.08,19.013,18]nonadeca-2(7),3,5,8,10,12(19),13,15,17-nonaen-4-yl)phenyl]phenyl]xanthen-9-one (PubChem CID 176758659) has the molecular formula C43H25NO2 and a molecular weight of 590.70 g/mol. Its IUPAC name is 2-[3-[3-(3,5,6-trideuterio-1-azapentacyclo[10.6.1.02,7.08,19.013,18]nonadeca-2(7),3,5,8,10,12(19),13,15,17-nonaen-4-yl)phenyl]phenyl]xanthen-9-one.
| Compound Name | 2-[3-[3-(3,5,6-trideuterio-1-azapentacyclo[10.6.1.02,7.08,19.013,18]nonadeca-2(7),3,5,8,10,12(19),13,15,17-nonaen-4-yl)phenyl]phenyl]xanthen-9-one |
|---|---|
| PubChem CID | 176758659 |
| Molecular Formula | C43H25NO2 |
| Molecular Weight | 590.70 g/mol |
| Exact Mass | 590.21 |
| IUPAC Name | 2-[3-[3-(3,5,6-trideuterio-1-azapentacyclo[10.6.1.02,7.08,19.013,18]nonadeca-2(7),3,5,8,10,12(19),13,15,17-nonaen-4-yl)phenyl]phenyl]xanthen-9-one |
| SMILES | [2H]c1c(-c2cccc(-c3cccc(-c4ccc5oc6ccccc6c(=O)c5c4)c3)c2)c([2H])c2c(c1[2H])c1cccc3c4ccccc4n2c31 |
| InChI | InChI=1S/C43H25NO2/c45-43-36-13-2-4-17-40(36)46-41-21-19-30(24-37(41)43)28-10-5-8-26(22-28)27-9-6-11-29(23-27)31-18-20-33-35-15-7-14-34-32-12-1-3-16-38(32)44(42(34)35)39(33)25-31/h1-25H/i18D,20D,25D |
| InChIKey | LCPFMOUABNTZQP-WJSMCQOTSA-N |
| XLogP | 11.10 |
| TPSA | 34.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.70 |
| LogP ≤ 5 | 11.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|