C31H23ClN2 — CID 176758761
4-(6-chloro-9,9-dimethylfluoren-3-yl)-2,6-diphenylpyrimidine (PubChem CID 176758761) has the molecular formula C31H23ClN2 and a molecular weight of 458.99 g/mol. Its IUPAC name is 4-(6-chloro-9,9-dimethylfluoren-3-yl)-2,6-diphenylpyrimidine.
| Compound Name | 4-(6-chloro-9,9-dimethylfluoren-3-yl)-2,6-diphenylpyrimidine |
|---|---|
| PubChem CID | 176758761 |
| Molecular Formula | C31H23ClN2 |
| Molecular Weight | 458.99 g/mol |
| Exact Mass | 458.15 |
| IUPAC Name | 4-(6-chloro-9,9-dimethylfluoren-3-yl)-2,6-diphenylpyrimidine |
| SMILES | CC1(C)c2ccc(Cl)cc2-c2cc(-c3cc(-c4ccccc4)nc(-c4ccccc4)n3)ccc21 |
| InChI | InChI=1S/C31H23ClN2/c1-31(2)26-15-13-22(17-24(26)25-18-23(32)14-16-27(25)31)29-19-28(20-9-5-3-6-10-20)33-30(34-29)21-11-7-4-8-12-21/h3-19H,1-2H3 |
| InChIKey | BRIXGXKLWFEBFU-UHFFFAOYSA-N |
| XLogP | 8.44 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.99 |
| LogP ≤ 5 | 8.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |