C33H65NO7 — CID 176758965
2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethyl 4-(didecylamino)-4-oxobutanoate (PubChem CID 176758965) has the molecular formula C33H65NO7 and a molecular weight of 587.88 g/mol. Its IUPAC name is 2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethyl 4-(didecylamino)-4-oxobutanoate.
| Compound Name | 2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethyl 4-(didecylamino)-4-oxobutanoate |
|---|---|
| PubChem CID | 176758965 |
| Molecular Formula | C33H65NO7 |
| Molecular Weight | 587.88 g/mol |
| Exact Mass | 587.48 |
| IUPAC Name | 2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethyl 4-(didecylamino)-4-oxobutanoate |
| SMILES | CCCCCCCCCCN(CCCCCCCCCC)C(=O)CCC(=O)OCCOCCOCCOCCOC |
| InChI | InChI=1S/C33H65NO7/c1-4-6-8-10-12-14-16-18-22-34(23-19-17-15-13-11-9-7-5-2)32(35)20-21-33(36)41-31-30-40-29-28-39-27-26-38-25-24-37-3/h4-31H2,1-3H3 |
| InChIKey | VQDOKSDKJFJEMT-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 83.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.88 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|