C25H29F4N7O — CID 176759186
4-N-[[5-[(3S)-3-amino-3-(2,2-difluoroethyl)piperidin-1-yl]-2-(2,5-difluoro-4-methoxyphenyl)-4-pyridinyl]methyl]pyridine-2,3,4-triamine (PubChem CID 176759186) has the molecular formula C25H29F4N7O and a molecular weight of 519.55 g/mol. Its IUPAC name is 4-N-[[5-[(3S)-3-amino-3-(2,2-difluoroethyl)piperidin-1-yl]-2-(2,5-difluoro-4-methoxyphenyl)-4-pyridinyl]methyl]pyridine-2,3,4-triamine.
| Compound Name | 4-N-[[5-[(3S)-3-amino-3-(2,2-difluoroethyl)piperidin-1-yl]-2-(2,5-difluoro-4-methoxyphenyl)-4-pyridinyl]methyl]pyridine-2,3,4-triamine |
|---|---|
| PubChem CID | 176759186 |
| Molecular Formula | C25H29F4N7O |
| Molecular Weight | 519.55 g/mol |
| Exact Mass | 519.24 |
| IUPAC Name | 4-N-[[5-[(3S)-3-amino-3-(2,2-difluoroethyl)piperidin-1-yl]-2-(2,5-difluoro-4-methoxyphenyl)-4-pyridinyl]methyl]pyridine-2,3,4-triamine |
| SMILES | COc1cc(F)c(-c2cc(CNc3ccnc(N)c3N)c(N3CCC[C@](N)(CC(F)F)C3)cn2)cc1F |
| InChI | InChI=1S/C25H29F4N7O/c1-37-21-9-16(26)15(8-17(21)27)19-7-14(11-34-18-3-5-33-24(31)23(18)30)20(12-35-19)36-6-2-4-25(32,13-36)10-22(28)29/h3,5,7-9,12,22H,2,4,6,10-11,13,30,32H2,1H3,(H3,31,33,34)/t25-/m0/s1 |
| InChIKey | HTNSNLZVJTVNNT-VWLOTQADSA-N |
| XLogP | 4.16 |
| TPSA | 128.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.55 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |