C38H37NO — CID 176759691
N-[4-(2,6-ditert-butylphenyl)phenyl]-8-phenyldibenzofuran-1-amine (PubChem CID 176759691) has the molecular formula C38H37NO and a molecular weight of 523.72 g/mol. Its IUPAC name is N-[4-(2,6-ditert-butylphenyl)phenyl]-8-phenyldibenzofuran-1-amine.
| Compound Name | N-[4-(2,6-ditert-butylphenyl)phenyl]-8-phenyldibenzofuran-1-amine |
|---|---|
| PubChem CID | 176759691 |
| Molecular Formula | C38H37NO |
| Molecular Weight | 523.72 g/mol |
| Exact Mass | 523.29 |
| IUPAC Name | N-[4-(2,6-ditert-butylphenyl)phenyl]-8-phenyldibenzofuran-1-amine |
| SMILES | CC(C)(C)c1cccc(C(C)(C)C)c1-c1ccc(Nc2cccc3oc4ccc(-c5ccccc5)cc4c23)cc1 |
| InChI | InChI=1S/C38H37NO/c1-37(2,3)30-14-10-15-31(38(4,5)6)35(30)26-18-21-28(22-19-26)39-32-16-11-17-34-36(32)29-24-27(20-23-33(29)40-34)25-12-8-7-9-13-25/h7-24,39H,1-6H3 |
| InChIKey | HEUZKGVWUYKNMX-UHFFFAOYSA-N |
| XLogP | 11.26 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.72 |
| LogP ≤ 5 | 11.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |