About 1-tert-butyl-3-[(E)-3,3-dimethylbut-1-enyl]-3-fluoroazetidine
1-tert-butyl-3-[(E)-3,3-dimethylbut-1-enyl]-3-fluoroazetidine (PubChem CID 176760620) has the molecular formula C13H24FN
and a molecular weight of 213.34 g/mol. Its IUPAC name is 1-tert-butyl-3-[(E)-3,3-dimethylbut-1-enyl]-3-fluoroazetidine.
Molecular Properties
| Compound Name | 1-tert-butyl-3-[(E)-3,3-dimethylbut-1-enyl]-3-fluoroazetidine |
| PubChem CID | 176760620 |
| Molecular Formula | C13H24FN |
| Molecular Weight | 213.34 g/mol |
| Exact Mass | 213.19 |
| IUPAC Name | 1-tert-butyl-3-[(E)-3,3-dimethylbut-1-enyl]-3-fluoroazetidine |
| SMILES | CC(C)(C)/C=C/C1(F)CN(C(C)(C)C)C1 |
| InChI | InChI=1S/C13H24FN/c1-11(2,3)7-8-13(14)9-15(10-13)12(4,5)6/h7-8H,9-10H2,1-6H3/b8-7+ |
| InChIKey | NCBGHAUJDHRHAR-BQYQJAHWSA-N |
| XLogP | 3.41 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.34 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-tert-butyl-3-[(E)-3,3-dimethylbut-1-enyl]-3-fluoroazetidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-tert-butyl-3-[(E)-3,3-dimethylbut-1-enyl]-3-fluoroazetidine?
The IUPAC name of 1-tert-butyl-3-[(E)-3,3-dimethylbut-1-enyl]-3-fluoroazetidine (CID 176760620) is 1-tert-butyl-3-[(E)-3,3-dimethylbut-1-enyl]-3-fluoroazetidine.
What is the SMILES notation for 1-tert-butyl-3-[(E)-3,3-dimethylbut-1-enyl]-3-fluoroazetidine?
The canonical SMILES for 1-tert-butyl-3-[(E)-3,3-dimethylbut-1-enyl]-3-fluoroazetidine is CC(C)(C)/C=C/C1(F)CN(C(C)(C)C)C1.
What is the InChIKey of 1-tert-butyl-3-[(E)-3,3-dimethylbut-1-enyl]-3-fluoroazetidine?
The InChIKey is NCBGHAUJDHRHAR-BQYQJAHWSA-N. The full InChI is InChI=1S/C13H24FN/c1-11(2,3)7-8-13(14)9-15(10-13)12(4,5)6/h7-8H,9-10H2,1-6H3/b8-7+.
What are the key properties of 1-tert-butyl-3-[(E)-3,3-dimethylbut-1-enyl]-3-fluoroazetidine?
1-tert-butyl-3-[(E)-3,3-dimethylbut-1-enyl]-3-fluoroazetidine has a molecular weight of 213.34 g/mol, XLogP of 3.41, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-tert-butyl-3-[(E)-3,3-dimethylbut-1-enyl]-3-fluoroazetidine is sourced from PubChem (CID 176760620), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).