5,8-dihydroimidazo[1,2-a]pyrazine-2-carboxylic acid

C7H7N3O2 — CID 176761340

IUPAC5,8-dihydroimidazo[1,2-a]pyrazine-2-carboxylic acid
SMILESO=C(O)c1cn2c(n1)CN=CC2
InChIInChI=1S/C7H7N3O2/c11-7(12)5-4-10-2-1-8-3-6(10)9-5/h1,4H,2-3H2,(H,11,12)
InChIKeyPGUDZEAKGUHJLK-UHFFFAOYSA-N
MW165.15 g/mol
LogP0.17
Rot. Bonds1

About 5,8-dihydroimidazo[1,2-a]pyrazine-2-carboxylic acid

5,8-dihydroimidazo[1,2-a]pyrazine-2-carboxylic acid (PubChem CID 176761340) has the molecular formula C7H7N3O2 and a molecular weight of 165.15 g/mol. Its IUPAC name is 5,8-dihydroimidazo[1,2-a]pyrazine-2-carboxylic acid.

Molecular Properties

Compound Name5,8-dihydroimidazo[1,2-a]pyrazine-2-carboxylic acid
PubChem CID176761340
Molecular FormulaC7H7N3O2
Molecular Weight165.15 g/mol
Exact Mass165.05
IUPAC Name5,8-dihydroimidazo[1,2-a]pyrazine-2-carboxylic acid
SMILESO=C(O)c1cn2c(n1)CN=CC2
InChIInChI=1S/C7H7N3O2/c11-7(12)5-4-10-2-1-8-3-6(10)9-5/h1,4H,2-3H2,(H,11,12)
InChIKeyPGUDZEAKGUHJLK-UHFFFAOYSA-N
XLogP0.17
TPSA67.48 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500165.15
LogP ≤ 50.17
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 5,8-dihydroimidazo[1,2-a]pyrazine-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5,8-dihydroimidazo[1,2-a]pyrazine-2-carboxylic acid?
The IUPAC name of 5,8-dihydroimidazo[1,2-a]pyrazine-2-carboxylic acid (CID 176761340) is 5,8-dihydroimidazo[1,2-a]pyrazine-2-carboxylic acid.
What is the SMILES notation for 5,8-dihydroimidazo[1,2-a]pyrazine-2-carboxylic acid?
The canonical SMILES for 5,8-dihydroimidazo[1,2-a]pyrazine-2-carboxylic acid is O=C(O)c1cn2c(n1)CN=CC2.
What is the InChIKey of 5,8-dihydroimidazo[1,2-a]pyrazine-2-carboxylic acid?
The InChIKey is PGUDZEAKGUHJLK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N3O2/c11-7(12)5-4-10-2-1-8-3-6(10)9-5/h1,4H,2-3H2,(H,11,12).
What are the key properties of 5,8-dihydroimidazo[1,2-a]pyrazine-2-carboxylic acid?
5,8-dihydroimidazo[1,2-a]pyrazine-2-carboxylic acid has a molecular weight of 165.15 g/mol, XLogP of 0.17, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5,8-dihydroimidazo[1,2-a]pyrazine-2-carboxylic acid is sourced from PubChem (CID 176761340), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).