C20H20FN5O — CID 176762078
N'-[2-[5-[2-[(4-fluorophenyl)methyl]cyclopropyl]-1H-1,2,4-triazol-3-yl]-6-methoxyphenyl]methanimidamide (PubChem CID 176762078) has the molecular formula C20H20FN5O and a molecular weight of 365.41 g/mol. Its IUPAC name is N'-[2-[5-[2-[(4-fluorophenyl)methyl]cyclopropyl]-1H-1,2,4-triazol-3-yl]-6-methoxyphenyl]methanimidamide.
| Compound Name | N'-[2-[5-[2-[(4-fluorophenyl)methyl]cyclopropyl]-1H-1,2,4-triazol-3-yl]-6-methoxyphenyl]methanimidamide |
|---|---|
| PubChem CID | 176762078 |
| Molecular Formula | C20H20FN5O |
| Molecular Weight | 365.41 g/mol |
| Exact Mass | 365.17 |
| IUPAC Name | N'-[2-[5-[2-[(4-fluorophenyl)methyl]cyclopropyl]-1H-1,2,4-triazol-3-yl]-6-methoxyphenyl]methanimidamide |
| SMILES | COc1cccc(-c2n[nH]c(C3CC3Cc3ccc(F)cc3)n2)c1/N=C/N |
| InChI | InChI=1S/C20H20FN5O/c1-27-17-4-2-3-15(18(17)23-11-22)19-24-20(26-25-19)16-10-13(16)9-12-5-7-14(21)8-6-12/h2-8,11,13,16H,9-10H2,1H3,(H2,22,23)(H,24,25,26) |
| InChIKey | SHMXUXYHDROQCM-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 89.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.41 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|