C19H17F2N5O — CID 176762092
N'-[4-fluoro-2-[5-[2-(4-fluorophenyl)cyclopropyl]-1H-1,2,4-triazol-3-yl]-6-methoxyphenyl]methanimidamide (PubChem CID 176762092) has the molecular formula C19H17F2N5O and a molecular weight of 369.38 g/mol. Its IUPAC name is N'-[4-fluoro-2-[5-[2-(4-fluorophenyl)cyclopropyl]-1H-1,2,4-triazol-3-yl]-6-methoxyphenyl]methanimidamide.
| Compound Name | N'-[4-fluoro-2-[5-[2-(4-fluorophenyl)cyclopropyl]-1H-1,2,4-triazol-3-yl]-6-methoxyphenyl]methanimidamide |
|---|---|
| PubChem CID | 176762092 |
| Molecular Formula | C19H17F2N5O |
| Molecular Weight | 369.38 g/mol |
| Exact Mass | 369.14 |
| IUPAC Name | N'-[4-fluoro-2-[5-[2-(4-fluorophenyl)cyclopropyl]-1H-1,2,4-triazol-3-yl]-6-methoxyphenyl]methanimidamide |
| SMILES | COc1cc(F)cc(-c2n[nH]c(C3CC3c3ccc(F)cc3)n2)c1/N=C/N |
| InChI | InChI=1S/C19H17F2N5O/c1-27-16-7-12(21)6-15(17(16)23-9-22)19-24-18(25-26-19)14-8-13(14)10-2-4-11(20)5-3-10/h2-7,9,13-14H,8H2,1H3,(H2,22,23)(H,24,25,26) |
| InChIKey | ZCCFLXUMMKXTKB-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 89.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.38 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|