C16H24ClNO3S — CID 176762378
(2'S,4R,7R)-2-chloro-1'-(3-hydroxybutyl)-2'-methylspiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine]-4-ol (PubChem CID 176762378) has the molecular formula C16H24ClNO3S and a molecular weight of 345.89 g/mol. Its IUPAC name is (2'S,4R,7R)-2-chloro-1'-(3-hydroxybutyl)-2'-methylspiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine]-4-ol.
| Compound Name | (2'S,4R,7R)-2-chloro-1'-(3-hydroxybutyl)-2'-methylspiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine]-4-ol |
|---|---|
| PubChem CID | 176762378 |
| Molecular Formula | C16H24ClNO3S |
| Molecular Weight | 345.89 g/mol |
| Exact Mass | 345.12 |
| IUPAC Name | (2'S,4R,7R)-2-chloro-1'-(3-hydroxybutyl)-2'-methylspiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine]-4-ol |
| SMILES | CC(O)CCN1CC[C@]2(C[C@@H]1C)OC[C@H](O)c1cc(Cl)sc12 |
| InChI | InChI=1S/C16H24ClNO3S/c1-10-8-16(4-6-18(10)5-3-11(2)19)15-12(7-14(17)22-15)13(20)9-21-16/h7,10-11,13,19-20H,3-6,8-9H2,1-2H3/t10-,11?,13-,16+/m0/s1 |
| InChIKey | IDOLRRHHZLVBNE-GVKXNSHQSA-N |
| XLogP | 2.92 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.89 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |