C50H32N4O — CID 176764513
9-[4-[4,6-bis(4-phenylphenyl)-1,3,5-triazin-2-yl]phenyl]-2-phenylbenzo[g][1,3]benzoxazole (PubChem CID 176764513) has the molecular formula C50H32N4O and a molecular weight of 704.83 g/mol. Its IUPAC name is 9-[4-[4,6-bis(4-phenylphenyl)-1,3,5-triazin-2-yl]phenyl]-2-phenylbenzo[g][1,3]benzoxazole.
| Compound Name | 9-[4-[4,6-bis(4-phenylphenyl)-1,3,5-triazin-2-yl]phenyl]-2-phenylbenzo[g][1,3]benzoxazole |
|---|---|
| PubChem CID | 176764513 |
| Molecular Formula | C50H32N4O |
| Molecular Weight | 704.83 g/mol |
| Exact Mass | 704.26 |
| IUPAC Name | 9-[4-[4,6-bis(4-phenylphenyl)-1,3,5-triazin-2-yl]phenyl]-2-phenylbenzo[g][1,3]benzoxazole |
| SMILES | c1ccc(-c2ccc(-c3nc(-c4ccc(-c5ccccc5)cc4)nc(-c4ccc(-c5cccc6ccc7nc(-c8ccccc8)oc7c56)cc4)n3)cc2)cc1 |
| InChI | InChI=1S/C50H32N4O/c1-4-11-33(12-5-1)35-19-25-39(26-20-35)47-52-48(40-27-21-36(22-28-40)34-13-6-2-7-14-34)54-49(53-47)41-29-23-37(24-30-41)43-18-10-17-38-31-32-44-46(45(38)43)55-50(51-44)42-15-8-3-9-16-42/h1-32H |
| InChIKey | KXQVCXFWYNDPES-UHFFFAOYSA-N |
| XLogP | 12.84 |
| TPSA | 64.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.83 |
| LogP ≤ 5 | 12.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |