About 2-(1H-pyrrol-2-yl)-3,1-benzoxathiin-4-one
2-(1H-pyrrol-2-yl)-3,1-benzoxathiin-4-one (PubChem CID 176765867) has the molecular formula C12H9NO2S
and a molecular weight of 231.28 g/mol. Its IUPAC name is 2-(1H-pyrrol-2-yl)-3,1-benzoxathiin-4-one.
Molecular Properties
| Compound Name | 2-(1H-pyrrol-2-yl)-3,1-benzoxathiin-4-one |
| PubChem CID | 176765867 |
| Molecular Formula | C12H9NO2S |
| Molecular Weight | 231.28 g/mol |
| Exact Mass | 231.04 |
| IUPAC Name | 2-(1H-pyrrol-2-yl)-3,1-benzoxathiin-4-one |
| SMILES | O=C1OC(c2ccc[nH]2)Sc2ccccc21 |
| InChI | InChI=1S/C12H9NO2S/c14-11-8-4-1-2-6-10(8)16-12(15-11)9-5-3-7-13-9/h1-7,12-13H |
| InChIKey | FAWWGCPWMHUAJN-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.28 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(1H-pyrrol-2-yl)-3,1-benzoxathiin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1H-pyrrol-2-yl)-3,1-benzoxathiin-4-one?
The IUPAC name of 2-(1H-pyrrol-2-yl)-3,1-benzoxathiin-4-one (CID 176765867) is 2-(1H-pyrrol-2-yl)-3,1-benzoxathiin-4-one.
What is the SMILES notation for 2-(1H-pyrrol-2-yl)-3,1-benzoxathiin-4-one?
The canonical SMILES for 2-(1H-pyrrol-2-yl)-3,1-benzoxathiin-4-one is O=C1OC(c2ccc[nH]2)Sc2ccccc21.
What is the InChIKey of 2-(1H-pyrrol-2-yl)-3,1-benzoxathiin-4-one?
The InChIKey is FAWWGCPWMHUAJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9NO2S/c14-11-8-4-1-2-6-10(8)16-12(15-11)9-5-3-7-13-9/h1-7,12-13H.
What are the key properties of 2-(1H-pyrrol-2-yl)-3,1-benzoxathiin-4-one?
2-(1H-pyrrol-2-yl)-3,1-benzoxathiin-4-one has a molecular weight of 231.28 g/mol, XLogP of 2.98, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1H-pyrrol-2-yl)-3,1-benzoxathiin-4-one is sourced from PubChem (CID 176765867), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).