C16H10O3S — CID 176765895
2-(1-benzothiophen-2-yl)-1,3-benzodioxin-4-one (PubChem CID 176765895) has the molecular formula C16H10O3S and a molecular weight of 282.32 g/mol. Its IUPAC name is 2-(1-benzothiophen-2-yl)-1,3-benzodioxin-4-one.
| Compound Name | 2-(1-benzothiophen-2-yl)-1,3-benzodioxin-4-one |
|---|---|
| PubChem CID | 176765895 |
| Molecular Formula | C16H10O3S |
| Molecular Weight | 282.32 g/mol |
| Exact Mass | 282.04 |
| IUPAC Name | 2-(1-benzothiophen-2-yl)-1,3-benzodioxin-4-one |
| SMILES | O=C1OC(c2cc3ccccc3s2)Oc2ccccc21 |
| InChI | InChI=1S/C16H10O3S/c17-15-11-6-2-3-7-12(11)18-16(19-15)14-9-10-5-1-4-8-13(10)20-14/h1-9,16H |
| InChIKey | HQOALRLRMIHDDX-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.32 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |