C16H18OS — CID 176765959
spiro[1,3-benzoxathiole-2,4'-tricyclo[5.2.1.02,6]decane] (PubChem CID 176765959) has the molecular formula C16H18OS and a molecular weight of 258.39 g/mol. Its IUPAC name is spiro[1,3-benzoxathiole-2,4'-tricyclo[5.2.1.02,6]decane].
| Compound Name | spiro[1,3-benzoxathiole-2,4'-tricyclo[5.2.1.02,6]decane] |
|---|---|
| PubChem CID | 176765959 |
| Molecular Formula | C16H18OS |
| Molecular Weight | 258.39 g/mol |
| Exact Mass | 258.11 |
| IUPAC Name | spiro[1,3-benzoxathiole-2,4'-tricyclo[5.2.1.02,6]decane] |
| SMILES | c1ccc2c(c1)OC1(CC3C4CCC(C4)C3C1)S2 |
| InChI | InChI=1S/C16H18OS/c1-2-4-15-14(3-1)17-16(18-15)8-12-10-5-6-11(7-10)13(12)9-16/h1-4,10-13H,5-9H2 |
| InChIKey | WSXUXRYMDRGNDL-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.39 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |