C45H40BN4OPt-3 — CID 176767254
[4-[8-[3-(3-methyl-2H-imidazol-2-id-1-yl)benzene-2-id-1-yl]oxy-9H-pyrido[3,2-b]indol-9-id-5-yl]phenyl]-bis(2,4,6-trimethylphenyl)borane;platinum (PubChem CID 176767254) has the molecular formula C45H40BN4OPt-3 and a molecular weight of 858.73 g/mol. Its IUPAC name is [4-[8-[3-(3-methyl-2H-imidazol-2-id-1-yl)benzene-2-id-1-yl]oxy-9H-pyrido[3,2-b]indol-9-id-5-yl]phenyl]-bis(2,4,6-trimethylphenyl)borane;platinum.
| Compound Name | [4-[8-[3-(3-methyl-2H-imidazol-2-id-1-yl)benzene-2-id-1-yl]oxy-9H-pyrido[3,2-b]indol-9-id-5-yl]phenyl]-bis(2,4,6-trimethylphenyl)borane;platinum |
|---|---|
| PubChem CID | 176767254 |
| Molecular Formula | C45H40BN4OPt-3 |
| Molecular Weight | 858.73 g/mol |
| Exact Mass | 858.30 |
| IUPAC Name | [4-[8-[3-(3-methyl-2H-imidazol-2-id-1-yl)benzene-2-id-1-yl]oxy-9H-pyrido[3,2-b]indol-9-id-5-yl]phenyl]-bis(2,4,6-trimethylphenyl)borane;platinum |
| SMILES | Cc1cc(C)c(B(c2ccc(-n3c4ccc(Oc5[c-]c(N6C=CN(C)[CH-]6)ccc5)[c-]c4c4ncccc43)cc2)c2c(C)cc(C)cc2C)c(C)c1.[Pt] |
| InChI | InChI=1S/C45H40BN4O.Pt/c1-29-22-31(3)43(32(4)23-29)46(44-33(5)24-30(2)25-34(44)6)35-13-15-36(16-14-35)50-41-18-17-39(27-40(41)45-42(50)12-9-19-47-45)51-38-11-8-10-37(26-38)49-21-20-48(7)28-49;/h8-25,28H,1-7H3;/q-3; |
| InChIKey | ULLOXSGKPPDNLM-UHFFFAOYSA-N |
| XLogP | 8.28 |
| TPSA | 33.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 858.73 |
| LogP ≤ 5 | 8.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|