C43H27N3O — CID 176767408
2-(4-dibenzofuran-1-ylphenyl)-4-[1,3,4,5,7,8-hexadeuterio-6-(2,3,4,5,6-pentadeuteriophenyl)naphthalen-2-yl]-6-phenyl-1,3,5-triazine (PubChem CID 176767408) has the molecular formula C43H27N3O and a molecular weight of 612.78 g/mol. Its IUPAC name is 2-(4-dibenzofuran-1-ylphenyl)-4-[1,3,4,5,7,8-hexadeuterio-6-(2,3,4,5,6-pentadeuteriophenyl)naphthalen-2-yl]-6-phenyl-1,3,5-triazine.
| Compound Name | 2-(4-dibenzofuran-1-ylphenyl)-4-[1,3,4,5,7,8-hexadeuterio-6-(2,3,4,5,6-pentadeuteriophenyl)naphthalen-2-yl]-6-phenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 176767408 |
| Molecular Formula | C43H27N3O |
| Molecular Weight | 612.78 g/mol |
| Exact Mass | 612.28 |
| IUPAC Name | 2-(4-dibenzofuran-1-ylphenyl)-4-[1,3,4,5,7,8-hexadeuterio-6-(2,3,4,5,6-pentadeuteriophenyl)naphthalen-2-yl]-6-phenyl-1,3,5-triazine |
| SMILES | [2H]c1c([2H])c([2H])c(-c2c([2H])c([2H])c3c([2H])c(-c4nc(-c5ccccc5)nc(-c5ccc(-c6cccc7oc8ccccc8c67)cc5)n4)c([2H])c([2H])c3c2[2H])c([2H])c1[2H] |
| InChI | InChI=1S/C43H27N3O/c1-3-10-28(11-4-1)32-22-23-34-27-35(25-24-33(34)26-32)43-45-41(30-12-5-2-6-13-30)44-42(46-43)31-20-18-29(19-21-31)36-15-9-17-39-40(36)37-14-7-8-16-38(37)47-39/h1-27H/i1D,3D,4D,10D,11D,22D,23D,24D,25D,26D,27D |
| InChIKey | YBBFLVJITFFAEA-VOZUCDDYSA-N |
| XLogP | 11.26 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.78 |
| LogP ≤ 5 | 11.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |