C16H20N2O2 — CID 176768469
tert-butyl (2R,4R)-4-isocyano-2-phenylpyrrolidine-1-carboxylate (PubChem CID 176768469) has the molecular formula C16H20N2O2 and a molecular weight of 272.35 g/mol. Its IUPAC name is tert-butyl (2R,4R)-4-isocyano-2-phenylpyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2R,4R)-4-isocyano-2-phenylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 176768469 |
| Molecular Formula | C16H20N2O2 |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.15 |
| IUPAC Name | tert-butyl (2R,4R)-4-isocyano-2-phenylpyrrolidine-1-carboxylate |
| SMILES | [C-]#[N+][C@@H]1C[C@H](c2ccccc2)N(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C16H20N2O2/c1-16(2,3)20-15(19)18-11-13(17-4)10-14(18)12-8-6-5-7-9-12/h5-9,13-14H,10-11H2,1-3H3/t13-,14-/m1/s1 |
| InChIKey | GYANOSSXOHODMA-ZIAGYGMSSA-N |
| XLogP | 3.66 |
| TPSA | 33.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|