C21H28FO7PS — CID 176768531
[[(R)-1-benzothiophen-5-yl(fluoro)methyl]-(2,2-dimethylpropanoyloxymethoxy)phosphoryl]oxymethyl 2,2-dimethylpropanoate (PubChem CID 176768531) has the molecular formula C21H28FO7PS and a molecular weight of 474.49 g/mol. Its IUPAC name is [[(R)-1-benzothiophen-5-yl(fluoro)methyl]-(2,2-dimethylpropanoyloxymethoxy)phosphoryl]oxymethyl 2,2-dimethylpropanoate.
| Compound Name | [[(R)-1-benzothiophen-5-yl(fluoro)methyl]-(2,2-dimethylpropanoyloxymethoxy)phosphoryl]oxymethyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 176768531 |
| Molecular Formula | C21H28FO7PS |
| Molecular Weight | 474.49 g/mol |
| Exact Mass | 474.13 |
| IUPAC Name | [[(R)-1-benzothiophen-5-yl(fluoro)methyl]-(2,2-dimethylpropanoyloxymethoxy)phosphoryl]oxymethyl 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OCOP(=O)(OCOC(=O)C(C)(C)C)[C@@H](F)c1ccc2sccc2c1 |
| InChI | InChI=1S/C21H28FO7PS/c1-20(2,3)18(23)26-12-28-30(25,29-13-27-19(24)21(4,5)6)17(22)15-7-8-16-14(11-15)9-10-31-16/h7-11,17H,12-13H2,1-6H3/t17-/m1/s1 |
| InChIKey | GIDVGYPIOXWCCW-QGZVFWFLSA-N |
| XLogP | 6.19 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.49 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|