About 2-fluoro-[1]benzofuro[3,2-c]pyrazole-7-carboxamide
2-fluoro-[1]benzofuro[3,2-c]pyrazole-7-carboxamide (PubChem CID 176770330) has the molecular formula C10H6FN3O2
and a molecular weight of 219.18 g/mol. Its IUPAC name is 2-fluoro-[1]benzofuro[3,2-c]pyrazole-7-carboxamide.
Molecular Properties
| Compound Name | 2-fluoro-[1]benzofuro[3,2-c]pyrazole-7-carboxamide |
| PubChem CID | 176770330 |
| Molecular Formula | C10H6FN3O2 |
| Molecular Weight | 219.18 g/mol |
| Exact Mass | 219.04 |
| IUPAC Name | 2-fluoro-[1]benzofuro[3,2-c]pyrazole-7-carboxamide |
| SMILES | NC(=O)c1ccc2oc3cn(F)nc3c2c1 |
| InChI | InChI=1S/C10H6FN3O2/c11-14-4-8-9(13-14)6-3-5(10(12)15)1-2-7(6)16-8/h1-4H,(H2,12,15) |
| InChIKey | ALDSPNWLISJIGT-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 74.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.18 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-fluoro-[1]benzofuro[3,2-c]pyrazole-7-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-[1]benzofuro[3,2-c]pyrazole-7-carboxamide?
The IUPAC name of 2-fluoro-[1]benzofuro[3,2-c]pyrazole-7-carboxamide (CID 176770330) is 2-fluoro-[1]benzofuro[3,2-c]pyrazole-7-carboxamide.
What is the SMILES notation for 2-fluoro-[1]benzofuro[3,2-c]pyrazole-7-carboxamide?
The canonical SMILES for 2-fluoro-[1]benzofuro[3,2-c]pyrazole-7-carboxamide is NC(=O)c1ccc2oc3cn(F)nc3c2c1.
What is the InChIKey of 2-fluoro-[1]benzofuro[3,2-c]pyrazole-7-carboxamide?
The InChIKey is ALDSPNWLISJIGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H6FN3O2/c11-14-4-8-9(13-14)6-3-5(10(12)15)1-2-7(6)16-8/h1-4H,(H2,12,15).
What are the key properties of 2-fluoro-[1]benzofuro[3,2-c]pyrazole-7-carboxamide?
2-fluoro-[1]benzofuro[3,2-c]pyrazole-7-carboxamide has a molecular weight of 219.18 g/mol, XLogP of 1.61, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-[1]benzofuro[3,2-c]pyrazole-7-carboxamide is sourced from PubChem (CID 176770330), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).