C18H10Cl2F2 — CID 176770627
1,2,3,4,5-pentadeuterio-6-[2,6-dichloro-3,5-difluoro-4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]benzene (PubChem CID 176770627) has the molecular formula C18H10Cl2F2 and a molecular weight of 345.24 g/mol. Its IUPAC name is 1,2,3,4,5-pentadeuterio-6-[2,6-dichloro-3,5-difluoro-4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]benzene.
| Compound Name | 1,2,3,4,5-pentadeuterio-6-[2,6-dichloro-3,5-difluoro-4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]benzene |
|---|---|
| PubChem CID | 176770627 |
| Molecular Formula | C18H10Cl2F2 |
| Molecular Weight | 345.24 g/mol |
| Exact Mass | 344.08 |
| IUPAC Name | 1,2,3,4,5-pentadeuterio-6-[2,6-dichloro-3,5-difluoro-4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]benzene |
| SMILES | [2H]c1c([2H])c([2H])c(-c2c(F)c(Cl)c(-c3c([2H])c([2H])c([2H])c([2H])c3[2H])c(Cl)c2F)c([2H])c1[2H] |
| InChI | InChI=1S/C18H10Cl2F2/c19-15-13(11-7-3-1-4-8-11)16(20)18(22)14(17(15)21)12-9-5-2-6-10-12/h1-10H/i1D,2D,3D,4D,5D,6D,7D,8D,9D,10D |
| InChIKey | CIBSJJNOHIVVBG-LHNTUAQVSA-N |
| XLogP | 6.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.24 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|