About CID 176770747
CID 176770747 (PubChem CID 176770747) has the molecular formula C90H106N4
and a molecular weight of 1243.87 g/mol.
Molecular Properties
| Compound Name | CID 176770747 |
| PubChem CID | 176770747 |
| Molecular Formula | C90H106N4 |
| Molecular Weight | 1243.87 g/mol |
| Exact Mass | 1242.84 |
| IUPAC Name | — |
| SMILES | [C-]#[N+]c1cc2c(c3c1C1(CCCC1)CC3)c1cc(C(CC)(CC)CC)cc3c4c(-c5c(C(C)C)cc(C(C)C)cc5C(C)C)c5c(c(-c6c(C(C)C)cc(C(C)C)cc6C(C)C)c4n2c13)c1cc(C(CC)(CC)CC)cc2c3c4c(c(C#N)cc3n5c21)C1(CCCC1)CC4 |
| InChI | InChI=1S/C90H106N4/c1-20-87(21-2,22-3)58-43-66-73-60-30-36-89(32-26-27-33-89)81(60)57(48-91)42-71(73)93-83(66)68(45-58)77-80(76-64(53(15)16)40-56(50(9)10)41-65(76)54(17)18)86-78(79(85(77)93)75-62(51(11)12)38-55(49(7)8)39-63(75)52(13)14)69-46-59(88(23-4,24-5)25-6)44-67-74-61-31-37-90(34-28-29-35-90)82(61)70(92-19)47-72(74)94(86)84(67)69/h38-47,49-54H,20-37H2,1-18H3 |
| InChIKey | VCWZRLYZQVAPHY-UHFFFAOYSA-N |
| XLogP | 26.94 |
| TPSA | 36.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 94 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 1243.87 |
| LogP ≤ 5 | 26.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze CID 176770747 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 176770747?
The IUPAC name of CID 176770747 (CID 176770747) is not available.
What is the SMILES notation for CID 176770747?
The canonical SMILES for CID 176770747 is [C-]#[N+]c1cc2c(c3c1C1(CCCC1)CC3)c1cc(C(CC)(CC)CC)cc3c4c(-c5c(C(C)C)cc(C(C)C)cc5C(C)C)c5c(c(-c6c(C(C)C)cc(C(C)C)cc6C(C)C)c4n2c13)c1cc(C(CC)(CC)CC)cc2c3c4c(c(C#N)cc3n5c21)C1(CCCC1)CC4.
What is the InChIKey of CID 176770747?
The InChIKey is VCWZRLYZQVAPHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C90H106N4/c1-20-87(21-2,22-3)58-43-66-73-60-30-36-89(32-26-27-33-89)81(60)57(48-91)42-71(73)93-83(66)68(45-58)77-80(76-64(53(15)16)40-56(50(9)10)41-65(76)54(17)18)86-78(79(85(77)93)75-62(51(11)12)38-55(49(7)8)39-63(75)52(13)14)69-46-59(88(23-4,24-5)25-6)44-67-74-61-31-37-90(34-28-29-35-90)82(61)70(92-19)47-72(74)94(86)84(67)69/h38-47,49-54H,20-37H2,1-18H3.
What are the key properties of CID 176770747?
CID 176770747 has a molecular weight of 1243.87 g/mol, XLogP of 26.94, 16 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 176770747 is sourced from PubChem (CID 176770747), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).