C25H26N4O3 — CID 176770977
bis[(E)-[1-(4-cyanophenyl)-2,2-dimethylpropylidene]amino] carbonate (PubChem CID 176770977) has the molecular formula C25H26N4O3 and a molecular weight of 430.51 g/mol. Its IUPAC name is bis[(E)-[1-(4-cyanophenyl)-2,2-dimethylpropylidene]amino] carbonate.
| Compound Name | bis[(E)-[1-(4-cyanophenyl)-2,2-dimethylpropylidene]amino] carbonate |
|---|---|
| PubChem CID | 176770977 |
| Molecular Formula | C25H26N4O3 |
| Molecular Weight | 430.51 g/mol |
| Exact Mass | 430.20 |
| IUPAC Name | bis[(E)-[1-(4-cyanophenyl)-2,2-dimethylpropylidene]amino] carbonate |
| SMILES | CC(C)(C)/C(=N\OC(=O)O/N=C(/c1ccc(C#N)cc1)C(C)(C)C)c1ccc(C#N)cc1 |
| InChI | InChI=1S/C25H26N4O3/c1-24(2,3)21(19-11-7-17(15-26)8-12-19)28-31-23(30)32-29-22(25(4,5)6)20-13-9-18(16-27)10-14-20/h7-14H,1-6H3/b28-21-,29-22- |
| InChIKey | NZWAVJOKIDXXQI-TWHPYYNWSA-N |
| XLogP | 5.78 |
| TPSA | 107.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.51 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|