C34H18N4O4 — CID 176771044
2-naphthalen-2-yl-6,13-dipyridin-4-yl-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1,3,8(16),9,11(15)-pentaene-5,7,12,14-tetrone (PubChem CID 176771044) has the molecular formula C34H18N4O4 and a molecular weight of 546.54 g/mol. Its IUPAC name is 2-naphthalen-2-yl-6,13-dipyridin-4-yl-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1,3,8(16),9,11(15)-pentaene-5,7,12,14-tetrone.
| Compound Name | 2-naphthalen-2-yl-6,13-dipyridin-4-yl-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1,3,8(16),9,11(15)-pentaene-5,7,12,14-tetrone |
|---|---|
| PubChem CID | 176771044 |
| Molecular Formula | C34H18N4O4 |
| Molecular Weight | 546.54 g/mol |
| Exact Mass | 546.13 |
| IUPAC Name | 2-naphthalen-2-yl-6,13-dipyridin-4-yl-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1,3,8(16),9,11(15)-pentaene-5,7,12,14-tetrone |
| SMILES | O=C1c2ccc3c4c(c(-c5ccc6ccccc6c5)cc(c24)C(=O)N1c1ccncc1)C(=O)N(c1ccncc1)C3=O |
| InChI | InChI=1S/C34H18N4O4/c39-31-24-7-8-25-29-28(24)27(33(41)37(31)22-9-13-35-14-10-22)18-26(21-6-5-19-3-1-2-4-20(19)17-21)30(29)34(42)38(32(25)40)23-11-15-36-16-12-23/h1-18H |
| InChIKey | JOKKLSNVYDKGMV-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 100.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.54 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|