C34H30N2O4 — CID 176771046
6,13-dicyclohexyl-2-(2-phenylethynyl)-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1,3,8(16),9,11(15)-pentaene-5,7,12,14-tetrone (PubChem CID 176771046) has the molecular formula C34H30N2O4 and a molecular weight of 530.62 g/mol. Its IUPAC name is 6,13-dicyclohexyl-2-(2-phenylethynyl)-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1,3,8(16),9,11(15)-pentaene-5,7,12,14-tetrone.
| Compound Name | 6,13-dicyclohexyl-2-(2-phenylethynyl)-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1,3,8(16),9,11(15)-pentaene-5,7,12,14-tetrone |
|---|---|
| PubChem CID | 176771046 |
| Molecular Formula | C34H30N2O4 |
| Molecular Weight | 530.62 g/mol |
| Exact Mass | 530.22 |
| IUPAC Name | 6,13-dicyclohexyl-2-(2-phenylethynyl)-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1,3,8(16),9,11(15)-pentaene-5,7,12,14-tetrone |
| SMILES | O=C1c2ccc3c4c(c(C#Cc5ccccc5)cc(c24)C(=O)N1C1CCCCC1)C(=O)N(C1CCCCC1)C3=O |
| InChI | InChI=1S/C34H30N2O4/c37-31-25-18-19-26-30-28(34(40)36(32(26)38)24-14-8-3-9-15-24)22(17-16-21-10-4-1-5-11-21)20-27(29(25)30)33(39)35(31)23-12-6-2-7-13-23/h1,4-5,10-11,18-20,23-24H,2-3,6-9,12-15H2 |
| InChIKey | MSEIOFRVYJYOKF-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.62 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|