C24H25FN4O — CID 176773584
2-[6-[(4-fluorophenyl)methyl]-5-hydrazinyl-3,3-dimethyl-2H-pyrrolo[3,2-b]pyridin-1-yl]-1-phenylethanone (PubChem CID 176773584) has the molecular formula C24H25FN4O and a molecular weight of 404.49 g/mol. Its IUPAC name is 2-[6-[(4-fluorophenyl)methyl]-5-hydrazinyl-3,3-dimethyl-2H-pyrrolo[3,2-b]pyridin-1-yl]-1-phenylethanone.
| Compound Name | 2-[6-[(4-fluorophenyl)methyl]-5-hydrazinyl-3,3-dimethyl-2H-pyrrolo[3,2-b]pyridin-1-yl]-1-phenylethanone |
|---|---|
| PubChem CID | 176773584 |
| Molecular Formula | C24H25FN4O |
| Molecular Weight | 404.49 g/mol |
| Exact Mass | 404.20 |
| IUPAC Name | 2-[6-[(4-fluorophenyl)methyl]-5-hydrazinyl-3,3-dimethyl-2H-pyrrolo[3,2-b]pyridin-1-yl]-1-phenylethanone |
| SMILES | CC1(C)CN(CC(=O)c2ccccc2)c2cc(Cc3ccc(F)cc3)c(NN)nc21 |
| InChI | InChI=1S/C24H25FN4O/c1-24(2)15-29(14-21(30)17-6-4-3-5-7-17)20-13-18(23(28-26)27-22(20)24)12-16-8-10-19(25)11-9-16/h3-11,13H,12,14-15,26H2,1-2H3,(H,27,28) |
| InChIKey | SLAFPMTZRISWAU-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.49 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|