C16H17BrN4O2 — CID 176774290
[5-[5-amino-3-(4-bromophenyl)-4-isocyanopyrazol-1-yl]oxan-2-yl]methanol (PubChem CID 176774290) has the molecular formula C16H17BrN4O2 and a molecular weight of 377.24 g/mol. Its IUPAC name is [5-[5-amino-3-(4-bromophenyl)-4-isocyanopyrazol-1-yl]oxan-2-yl]methanol.
| Compound Name | [5-[5-amino-3-(4-bromophenyl)-4-isocyanopyrazol-1-yl]oxan-2-yl]methanol |
|---|---|
| PubChem CID | 176774290 |
| Molecular Formula | C16H17BrN4O2 |
| Molecular Weight | 377.24 g/mol |
| Exact Mass | 376.05 |
| IUPAC Name | [5-[5-amino-3-(4-bromophenyl)-4-isocyanopyrazol-1-yl]oxan-2-yl]methanol |
| SMILES | [C-]#[N+]c1c(-c2ccc(Br)cc2)nn(C2CCC(CO)OC2)c1N |
| InChI | InChI=1S/C16H17BrN4O2/c1-19-15-14(10-2-4-11(17)5-3-10)20-21(16(15)18)12-6-7-13(8-22)23-9-12/h2-5,12-13,22H,6-9,18H2 |
| InChIKey | NLWOUUVYINZXTN-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 77.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.24 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|