About 3-(oxo-phenyl-prop-2-enyl-λ6-sulfanylidene)-1,1-di(propan-2-yl)urea
3-(oxo-phenyl-prop-2-enyl-λ6-sulfanylidene)-1,1-di(propan-2-yl)urea (PubChem CID 176774402) has the molecular formula C16H24N2O2S
and a molecular weight of 308.45 g/mol. Its IUPAC name is 3-(oxo-phenyl-prop-2-enyl-λ6-sulfanylidene)-1,1-di(propan-2-yl)urea.
Molecular Properties
| Compound Name | 3-(oxo-phenyl-prop-2-enyl-λ6-sulfanylidene)-1,1-di(propan-2-yl)urea |
| PubChem CID | 176774402 |
| Molecular Formula | C16H24N2O2S |
| Molecular Weight | 308.45 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | 3-(oxo-phenyl-prop-2-enyl-λ6-sulfanylidene)-1,1-di(propan-2-yl)urea |
| SMILES | C=CC[S@@](=O)(=NC(=O)N(C(C)C)C(C)C)c1ccccc1 |
| InChI | InChI=1S/C16H24N2O2S/c1-6-12-21(20,15-10-8-7-9-11-15)17-16(19)18(13(2)3)14(4)5/h6-11,13-14H,1,12H2,2-5H3/t21-/m0/s1 |
| InChIKey | YMWVIDONIPJTJI-NRFANRHFSA-N |
| XLogP | 3.94 |
| TPSA | 49.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.45 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-(oxo-phenyl-prop-2-enyl-λ6-sulfanylidene)-1,1-di(propan-2-yl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(oxo-phenyl-prop-2-enyl-λ6-sulfanylidene)-1,1-di(propan-2-yl)urea?
The IUPAC name of 3-(oxo-phenyl-prop-2-enyl-λ6-sulfanylidene)-1,1-di(propan-2-yl)urea (CID 176774402) is 3-(oxo-phenyl-prop-2-enyl-λ6-sulfanylidene)-1,1-di(propan-2-yl)urea.
What is the SMILES notation for 3-(oxo-phenyl-prop-2-enyl-λ6-sulfanylidene)-1,1-di(propan-2-yl)urea?
The canonical SMILES for 3-(oxo-phenyl-prop-2-enyl-λ6-sulfanylidene)-1,1-di(propan-2-yl)urea is C=CC[S@@](=O)(=NC(=O)N(C(C)C)C(C)C)c1ccccc1.
What is the InChIKey of 3-(oxo-phenyl-prop-2-enyl-λ6-sulfanylidene)-1,1-di(propan-2-yl)urea?
The InChIKey is YMWVIDONIPJTJI-NRFANRHFSA-N. The full InChI is InChI=1S/C16H24N2O2S/c1-6-12-21(20,15-10-8-7-9-11-15)17-16(19)18(13(2)3)14(4)5/h6-11,13-14H,1,12H2,2-5H3/t21-/m0/s1.
What are the key properties of 3-(oxo-phenyl-prop-2-enyl-λ6-sulfanylidene)-1,1-di(propan-2-yl)urea?
3-(oxo-phenyl-prop-2-enyl-λ6-sulfanylidene)-1,1-di(propan-2-yl)urea has a molecular weight of 308.45 g/mol, XLogP of 3.94, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(oxo-phenyl-prop-2-enyl-λ6-sulfanylidene)-1,1-di(propan-2-yl)urea is sourced from PubChem (CID 176774402), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).