C19H24O4 — CID 176774595
methyl (2Z,4E)-5-[(1R)-1-hydroxy-2,2-dimethyl-4-oxo-4a,8a-dihydro-3H-naphthalen-1-yl]-3-methylpenta-2,4-dienoate (PubChem CID 176774595) has the molecular formula C19H24O4 and a molecular weight of 316.40 g/mol. Its IUPAC name is methyl (2Z,4E)-5-[(1R)-1-hydroxy-2,2-dimethyl-4-oxo-4a,8a-dihydro-3H-naphthalen-1-yl]-3-methylpenta-2,4-dienoate.
| Compound Name | methyl (2Z,4E)-5-[(1R)-1-hydroxy-2,2-dimethyl-4-oxo-4a,8a-dihydro-3H-naphthalen-1-yl]-3-methylpenta-2,4-dienoate |
|---|---|
| PubChem CID | 176774595 |
| Molecular Formula | C19H24O4 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.17 |
| IUPAC Name | methyl (2Z,4E)-5-[(1R)-1-hydroxy-2,2-dimethyl-4-oxo-4a,8a-dihydro-3H-naphthalen-1-yl]-3-methylpenta-2,4-dienoate |
| SMILES | COC(=O)/C=C(C)\C=C\[C@@]1(O)C2C=CC=CC2C(=O)CC1(C)C |
| InChI | InChI=1S/C19H24O4/c1-13(11-17(21)23-4)9-10-19(22)15-8-6-5-7-14(15)16(20)12-18(19,2)3/h5-11,14-15,22H,12H2,1-4H3/b10-9+,13-11-/t14?,15?,19-/m1/s1 |
| InChIKey | QPMVHLWZLSORCF-QFKWKTKQSA-N |
| XLogP | 2.75 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|