C15H25NO6S — CID 176775681
1-O-(2-hydroxyethyl) 6-O-(2-methoxyethyl) 3-cyano-2,3-dimethyl-2-(sulfanylmethyl)hexanedioate (PubChem CID 176775681) has the molecular formula C15H25NO6S and a molecular weight of 347.43 g/mol. Its IUPAC name is 1-O-(2-hydroxyethyl) 6-O-(2-methoxyethyl) 3-cyano-2,3-dimethyl-2-(sulfanylmethyl)hexanedioate.
| Compound Name | 1-O-(2-hydroxyethyl) 6-O-(2-methoxyethyl) 3-cyano-2,3-dimethyl-2-(sulfanylmethyl)hexanedioate |
|---|---|
| PubChem CID | 176775681 |
| Molecular Formula | C15H25NO6S |
| Molecular Weight | 347.43 g/mol |
| Exact Mass | 347.14 |
| IUPAC Name | 1-O-(2-hydroxyethyl) 6-O-(2-methoxyethyl) 3-cyano-2,3-dimethyl-2-(sulfanylmethyl)hexanedioate |
| SMILES | COCCOC(=O)CCC(C)(C#N)C(C)(CS)C(=O)OCCO |
| InChI | InChI=1S/C15H25NO6S/c1-14(10-16,5-4-12(18)21-9-8-20-3)15(2,11-23)13(19)22-7-6-17/h17,23H,4-9,11H2,1-3H3 |
| InChIKey | QGCMQHHWSATDAD-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 105.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.43 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|