About CID 176776135
CID 176776135 (PubChem CID 176776135) has the molecular formula C15H23F2N
and a molecular weight of 257.36 g/mol.
Molecular Properties
| Compound Name | CID 176776135 |
| PubChem CID | 176776135 |
| Molecular Formula | C15H23F2N |
| Molecular Weight | 257.36 g/mol |
| Exact Mass | 257.19 |
| IUPAC Name | — |
| SMILES | [2H]C([2H])(C(C)C)[C@]12C[C@@]3(CN1CCC21CC1)CC3(F)F |
| InChI | InChI=1S/C15H23F2N/c1-11(2)7-14-8-13(9-15(13,16)17)10-18(14)6-5-12(14)3-4-12/h11H,3-10H2,1-2H3/t13-,14+/m0/s1/i7D2 |
| InChIKey | CLITTWKVDRZCPT-ZHNFOSDWSA-N |
| XLogP | 3.69 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.36 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze CID 176776135 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 176776135?
The IUPAC name of CID 176776135 (CID 176776135) is not available.
What is the SMILES notation for CID 176776135?
The canonical SMILES for CID 176776135 is [2H]C([2H])(C(C)C)[C@]12C[C@@]3(CN1CCC21CC1)CC3(F)F.
What is the InChIKey of CID 176776135?
The InChIKey is CLITTWKVDRZCPT-ZHNFOSDWSA-N. The full InChI is InChI=1S/C15H23F2N/c1-11(2)7-14-8-13(9-15(13,16)17)10-18(14)6-5-12(14)3-4-12/h11H,3-10H2,1-2H3/t13-,14+/m0/s1/i7D2.
What are the key properties of CID 176776135?
CID 176776135 has a molecular weight of 257.36 g/mol, XLogP of 3.69, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 176776135 is sourced from PubChem (CID 176776135), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).